From a0d580ab25f91657b05acdadc47cd0999de102c7 Mon Sep 17 00:00:00 2001
From: montezdesousa <79287829+montezdesousa@users.noreply.github.com>
Date: Wed, 1 May 2024 22:17:02 +0100
Subject: [Feature] - Display command providers (#6355)

* fix: avoid calling Session() multiple times

* rename session refs

* fix: cmd text

* fix: avoid Session()

* fix: add providers by cmd

* fix: timezones

---------

Co-authored-by: Igor Radovanovic <74266147+IgorWounds@users.noreply.github.com>
---
 cli/openbb_cli/config/console.py                   |  10 +-
 cli/openbb_cli/config/menu_text.py                 | 169 +++++++++++----------
 cli/openbb_cli/controllers/base_controller.py      |  99 ++++++------
 .../controllers/base_platform_controller.py        |  26 ++--
 cli/openbb_cli/controllers/choices.py              |   8 +-
 cli/openbb_cli/controllers/cli_controller.py       |  77 +++++-----
 .../controllers/feature_flags_controller.py        |  87 ++++++-----
 cli/openbb_cli/controllers/hub_service.py          |  13 +-
 cli/openbb_cli/controllers/script_parser.py        |   6 +-
 9 files changed, 254 insertions(+), 241 deletions(-)

diff --git a/cli/openbb_cli/config/console.py b/cli/openbb_cli/config/console.py
index f19904cedc4..cbb0f8f2696 100644
--- a/cli/openbb_cli/config/console.py
+++ b/cli/openbb_cli/config/console.py
@@ -31,12 +31,8 @@ class Console:
         self.menu_text = ""
         self.menu_path = ""
 
-    def capture(self):
-        """Capture the console output."""
-        return self._console.capture()
-
     @staticmethod
-    def filter_rich_tags(text):
+    def _filter_rich_tags(text):
         """Filter out rich tags from text."""
         for val in RICH_TAGS:
             text = text.replace(val, "")
@@ -44,7 +40,7 @@ class Console:
         return text
 
     @staticmethod
-    def blend_text(
+    def _blend_text(
         message: str, color1: Tuple[int, int, int], color2: Tuple[int, int, int]
     ) -> Text:
         """Blend text from one color to another."""
@@ -85,7 +81,7 @@ class Console:
                 else:
                     self._console.print(kwargs["text"])
             else:
-                print(self.filter_rich_tags(kwargs["text"]))  # noqa: T201
+                print(self._filter_rich_tags(kwargs["text"]))  # noqa: T201
         elif not self._settings.TEST_MODE:
             self._console.print(*args, **kwargs)
         else:
diff --git a/cli/openbb_cli/config/menu_text.py b/cli/openbb_cli/config/menu_text.py
index 39bfa5787e9..d9bdc59656c 100644
--- a/cli/openbb_cli/config/menu_text.py
+++ b/cli/openbb_cli/config/menu_text.py
@@ -2,7 +2,7 @@
 
 __docformat__ = "numpy"
 
-from typing import Dict, List, Optional, Union
+from typing import Dict, List
 
 import i18n
 from openbb import obb
@@ -29,18 +29,18 @@ RICH_TAGS = [
 USE_COLOR = True
 
 
-def get_ordered_list_sources(command_path: str) -> List:
-    """Return the preferred source for the given command.
+def get_ordered_providers(command_path: str) -> List:
+    """Return the preferred provider for the given command.
 
     Parameters
     ----------
     command_path: str
-        The command to find the source for. E.g. "/equity/price/historical
+        The command to find the provider for. E.g. "/equity/price/historical
 
     Returns
     -------
     List
-        The list of sources for the given command.
+        The list of providers for the given command.
     """
     command_reference = obb.reference.get("paths", {}).get(command_path, {})  # type: ignore
     if command_reference:
@@ -52,7 +52,12 @@ def get_ordered_list_sources(command_path: str) -> List:
 class MenuText:
     """Create menu text with rich colors to be displayed by CLI."""
 
-    def __init__(self, path: str = "", column_sources: int = 100):
+    CMD_NAME_LENGTH = 18
+    CMD_DESCRIPTION_LENGTH = 65
+    CMD_PROVIDERS_LENGTH = 23
+    SECTION_SPACING = 4
+
+    def __init__(self, path: str = ""):
         """Initialize menu help.
 
         Parameters
@@ -64,7 +69,6 @@ class MenuText:
         """
         self.menu_text = ""
         self.menu_path = path
-        self.col_src = column_sources
         self.warnings: List[Dict[str, str]] = []
 
     def add_raw(self, raw_text: str):
@@ -117,146 +121,153 @@ class MenuText:
         )
         self.menu_text += f"[param]{parameter_translated}{space}:[/param] {value}\n"
 
-    def _adjust_command_length(self, key_command: str) -> str:
+    def _format_cmd_name(self, name: str) -> str:
         """Adjust the length of the command if it is too long.
 
         Parameters
         ----------
-        key_command : str
-            command to be adjusted
+        name : str
+            command to be formatted
 
         Returns
         -------
         str
-            adjusted command
+            formatted command
         """
-        if len(key_command) > 18:
-            new_key_command = key_command[:18]  # Default to trimming to 18 characters
+        if len(name) > self.CMD_NAME_LENGTH:
+            new_name = name[
+                : self.CMD_NAME_LENGTH
+            ]  # Default to trimming to 18 characters
 
-            if "_" in key_command:
-                key_command_split = key_command.split("_")
+            if "_" in name:
+                name_split = name.split("_")
 
-                new_key_command = (
-                    "_".join(key_command_split[:2])
-                    if len(key_command_split) > 2
-                    else key_command_split[0]
+                new_name = (
+                    "_".join(name_split[:2]) if len(name_split) > 2 else name_split[0]
                 )
 
-                if len(new_key_command) > 18:
-                    new_key_command = new_key_command[:18]
+                if len(new_name) > self.CMD_NAME_LENGTH:
+                    new_name = new_name[: self.CMD_NAME_LENGTH]
 
-            if new_key_command != key_command:
+            if new_name != name:
                 self.warnings.append(
                     {
                         "warning": "Command name too long",
-                        "command": key_command,
-                        "trimmed_command": new_key_command,
+                        "command": name,
+                        "trimmed_command": new_name,
                     }
                 )
-                key_command = new_key_command
+                name = new_name
 
-        return key_command
+        return name
 
-    def _handle_command_description(
-        self, key_command: str, command_description: str
+    def _format_cmd_description(
+        self, name: str, description: str, trim: bool = True
     ) -> str:
         """Handle the command description.
 
         Parameters
         ----------
-        key_command : str
+        name : str
             command to be adjusted
-        command_description : str
+        description : str
             description of the command
+        trim : bool
+            If true, the description will be trimmed to the maximum length
 
         Returns
         -------
         str
             adjusted command description
         """
-        if not command_description:
-            command_description = i18n.t(self.menu_path + key_command)
-            if command_description == self.menu_path + key_command:
-                command_description = ""
+        if not description:
+            description = i18n.t(self.menu_path + name)
+            if description == self.menu_path + name:
+                description = ""
         return (
-            command_description[:88] + "..."
-            if len(command_description) > 91
-            else command_description
+            description[: self.CMD_DESCRIPTION_LENGTH - 3] + "..."
+            if len(description) > self.CMD_DESCRIPTION_LENGTH and trim
+            else description
         )
 
-    def add_cmd(
-        self, key_command: str, condition: bool = True, command_description: str = ""
-    ):
+    def add_cmd(self, name: str, description: str = "", disable: bool = False):
         """Append command text (after translation from key) to a menu.
 
         Parameters
         ----------
-        key_command : str
+        name : str
             key command to be executed by user. It is also used as a key to get description of command.
-        condition : bool
-            condition in which command is available to user. I.e. displays command and description.
-            If condition is false, the command line is greyed out.
+        description : str
+            description of the command
+        disable : bool
+            If disable is true, the command line is greyed out.
         """
-        key_command = self._adjust_command_length(key_command)
-        command_description = self._handle_command_description(
-            key_command, command_description
+        formatted_name = self._format_cmd_name(name)
+        name_padding = (self.CMD_NAME_LENGTH - len(formatted_name)) * " "
+        providers = get_ordered_providers(f"{self.menu_path}{formatted_name}")
+        formatted_description = self._format_cmd_description(
+            formatted_name,
+            description,
+            bool(providers),
         )
-        spacing = (23 - (len(key_command) + 4)) * " "
-
-        cmd = f"{key_command}{spacing}{command_description}"
-        cmd = f"[cmds]    {cmd}[/cmds]" if condition else f"[unvl]    {cmd}[/unvl]"
-
-        sources = get_ordered_list_sources(f"{self.menu_path}{key_command}")
-
-        if sources:
-            space = (self.col_src - len(cmd)) * " " if self.col_src > len(cmd) else " "
-            cmd += f"{space}[src][{', '.join(sources)}][/src]"
+        description_padding = (
+            self.CMD_DESCRIPTION_LENGTH - len(formatted_description)
+        ) * " "
+        spacing = self.SECTION_SPACING * " "
+        description_padding = (
+            self.CMD_DESCRIPTION_LENGTH - len(formatted_description)
+        ) * " "
+        cmd = f"{spacing}{formatted_name + name_padding}{spacing}{formatted_description+description_padding}"
+        cmd = f"[unvl]{cmd}[/unvl]" if disable else f"[cmds]{cmd}[/cmds]"
+
+        if providers:
+            cmd += rf"{spacing}[src]\[{', '.join(providers)}][/src]"
 
         self.menu_text += cmd + "\n"
 
     def add_menu(
         self,
-        key_menu: str,
-        condition: Optional[Union[bool, str]] = True,
-        menu_description: str = "",
+        name: str,
+        description: str = "",
+        disable: bool = False,
     ):
         """Append menu text (after translation from key) to a menu.
 
         Parameters
         ----------
-        key_menu : str
+        name : str
             key menu to be executed by user. It is also used as a key to get description of menu.
-        condition : bool
-            condition in which menu is available to user. I.e. displays menu and description.
-            If condition is false, the menu line is greyed out.
+        disable : bool
+            If disable is true, the menu line is greyed out.
         """
-        spacing = (23 - (len(key_menu) + 4)) * " "
+        spacing = (self.CMD_NAME_LENGTH - len(name) + self.SECTION_SPACING) * " "
 
-        if menu_description:
-            menu = f"{key_menu}{spacing}{menu_description}"
+        if description:
+            menu = f"{name}{spacing}{description}"
         else:
-            menu_description = i18n.t(self.menu_path + key_menu)
-            if menu_description == self.menu_path + key_menu:
-                menu_description = ""
-            menu = f"{key_menu}{spacing}{menu_description}"
+            description = i18n.t(self.menu_path + name)
+            if description == self.menu_path + name:
+                description = ""
+            menu = f"{name}{spacing}{description}"
 
-        if condition:
-            self.menu_text += f"[menu]>   {menu}[/menu]\n"
-        else:
+        if disable:
             self.menu_text += f"[unvl]>   {menu}[/unvl]\n"
+        else:
+            self.menu_text += f"[menu]>   {menu}[/menu]\n"
 
-    def add_setting(self, key_setting: str, status: bool = True):
+    def add_setting(self, name: str, status: bool = True):
         """Append menu text (after translation from key) to a menu.
 
         Parameters
         ----------
-        key_setting : str
+        name : str
             key setting to be set by user. It is also used as a key to get description of the setting.
         status : bool
             status of the current setting. If true the line will be green, otherwise red.
         """
-        spacing = (23 - (len(key_setting) + 4)) * " "
+        spacing = (self.CMD_NAME_LENGTH - len(name) + self.SECTION_SPACING) * " "
+        indentation = self.SECTION_SPACING * " "
         if status:
-            self.menu_text += f"[green]    {key_setting}{spacing}{i18n.t(self.menu_path + key_setting)}[/green]\n"
+            self.menu_text += f"[green]{indentation}{name}{spacing}{i18n.t(self.menu_path + name)}[/green]\n"
         else:
-            self.menu_text += f"[red]    {key_setting}{spacing}{i18n.t(self.menu_path + key_setting)}[/red]\n"
+            self.menu_text += f"[red]{indentation}{name}{spacing}{i18n.t(self.menu_path + name)}[/red]\n"
diff --git a/cli/openbb_cli/controllers/base_controller.py b/cli/openbb_cli/controllers/base_controller.py
index 7d0c3fe27cc..a3d8b20aa16 100644
--- a/cli/openbb_cli/controllers/base_controller.py
+++ b/cli/openbb_cli/controllers/base_controller.py
@@ -31,6 +31,7 @@ from prompt_toolkit.styles import Style
 # pylint: disable=R0912
 
 controllers: Dict[str, Any] = {}
+session = Session()
 
 
 # TODO: We should try to avoid these global variables
@@ -132,7 +133,7 @@ class BaseController(metaclass=ABCMeta):
 
     def load_class(self, class_ins, *args, **kwargs):
         """Check for an existing instance of the controller before creating a new one."""
-        settings = Session().settings
+        settings = session.settings
         self.save_class()
         arguments = len(args) + len(kwargs)
         # Due to the 'arguments == 1' condition, we actually NEVER load a class
@@ -267,7 +268,7 @@ class BaseController(metaclass=ABCMeta):
 
     def save_class(self) -> None:
         """Save the current instance of the class to be loaded later."""
-        if Session().settings.REMEMBER_CONTEXTS:
+        if session.settings.REMEMBER_CONTEXTS:
             controllers[self.PATH] = self
 
     def custom_reset(self) -> List[str]:
@@ -321,7 +322,7 @@ class BaseController(metaclass=ABCMeta):
         actions = self.parse_input(an_input)
 
         if an_input and an_input != "reset":
-            Session().console.print()
+            session.console.print()
 
         # Empty command
         if len(actions) == 0:
@@ -374,7 +375,7 @@ class BaseController(metaclass=ABCMeta):
                 not self.queue or (self.queue and self.queue[0] not in ("quit", "help"))
             )
         ):
-            Session().console.print()
+            session.console.print()
 
         return self.queue
 
@@ -385,7 +386,7 @@ class BaseController(metaclass=ABCMeta):
     def call_home(self, _) -> None:
         """Process home command."""
         self.save_class()
-        if self.PATH.count("/") == 1 and Session().settings.ENABLE_EXIT_AUTO_HELP:
+        if self.PATH.count("/") == 1 and session.settings.ENABLE_EXIT_AUTO_HELP:
             self.print_help()
         for _ in range(self.PATH.count("/") - 1):
             self.queue.insert(0, "quit")
@@ -406,9 +407,9 @@ class BaseController(metaclass=ABCMeta):
         for _ in range(self.PATH.count("/")):
             self.queue.insert(0, "quit")
 
-        if not Session().is_local():
+        if not session.is_local():
             remove_file(
-                Path(Session().user.preferences.export_directory, "routines", "hub")
+                Path(session.user.preferences.export_directory, "routines", "hub")
             )
 
     def call_reset(self, _) -> None:
@@ -502,7 +503,7 @@ class BaseController(metaclass=ABCMeta):
 
         if ns_parser:
             if not ns_parser.name:
-                Session().console.print(
+                session.console.print(
                     "[red]Set a routine title by using the '-n' flag. E.g. 'record -n Morning routine'[/red]"
                 )
                 return
@@ -513,7 +514,7 @@ class BaseController(metaclass=ABCMeta):
                 else ns_parser.tag1
             )
             if tag1 and tag1 not in SCRIPT_TAGS:
-                Session().console.print(
+                session.console.print(
                     f"[red]The parameter 'tag1' needs to be one of the following {', '.join(SCRIPT_TAGS)}[/red]"
                 )
                 return
@@ -524,7 +525,7 @@ class BaseController(metaclass=ABCMeta):
                 else ns_parser.tag2
             )
             if tag2 and tag2 not in SCRIPT_TAGS:
-                Session().console.print(
+                session.console.print(
                     f"[red]The parameter 'tag2' needs to be one of the following {', '.join(SCRIPT_TAGS)}[/red]"
                 )
                 return
@@ -535,19 +536,19 @@ class BaseController(metaclass=ABCMeta):
                 else ns_parser.tag3
             )
             if tag3 and tag3 not in SCRIPT_TAGS:
-                Session().console.print(
+                session.console.print(
                     f"[red]The parameter 'tag3' needs to be one of the following {', '.join(SCRIPT_TAGS)}[/red]"
                 )
                 return
 
-            if Session().is_local() and not ns_parser.local:
-                Session().console.print(
+            if session.is_local() and not ns_parser.local:
+                session.console.print(
                     "[red]Recording session to the OpenBB Hub is not supported in guest mode.[/red]"
                 )
-                Session().console.print(
+                session.console.print(
                     "\n[yellow]Sign to OpenBB Hub to register: http://openbb.co[/yellow]"
                 )
-                Session().console.print(
+                session.console.print(
                     "\n[yellow]Otherwise set the flag '-l' to save the file locally.[/yellow]"
                 )
                 return
@@ -556,7 +557,7 @@ class BaseController(metaclass=ABCMeta):
             title = " ".join(ns_parser.name) if ns_parser.name else ""
             pattern = re.compile(r"^[a-zA-Z0-9\s]+$")
             if not pattern.match(title):
-                Session().console.print(
+                session.console.print(
                     f"[red]Title '{title}' has invalid format. Please use only digits, characters and whitespaces.[/]"
                 )
                 return
@@ -582,10 +583,10 @@ class BaseController(metaclass=ABCMeta):
 
             SESSION_RECORDED_PUBLIC = ns_parser.public
 
-            Session().console.print(
+            session.console.print(
                 f"[green]The routine '{title}' is successfully being recorded.[/green]"
             )
-            Session().console.print(
+            session.console.print(
                 "\n[yellow]Remember to run 'stop' command when you are done!\n[/yellow]"
             )
 
@@ -595,15 +596,15 @@ class BaseController(metaclass=ABCMeta):
         global SESSION_RECORDED  # noqa: PLW0603
 
         if not RECORD_SESSION:
-            Session().console.print(
+            session.console.print(
                 "[red]There is no session being recorded. Start one using the command 'record'[/red]\n"
             )
         elif len(SESSION_RECORDED) < 5:
-            Session().console.print(
+            session.console.print(
                 "[red]Run at least 4 commands before stopping recording a session.[/red]\n"
             )
         else:
-            current_user = Session().user
+            current_user = session.user
 
             # Check if the user just wants to store routine locally
             # This works regardless of whether they are logged in or not
@@ -620,14 +621,14 @@ class BaseController(metaclass=ABCMeta):
 
                 # If file already exists, add a timestamp to the name
                 if os.path.isfile(routine_file):
-                    i = Session().console.input(
+                    i = session.console.input(
                         "A local routine with the same name already exists, "
                         "do you want to override it? (y/n): "
                     )
-                    Session().console.print("")
+                    session.console.print("")
                     while i.lower() not in ["y", "yes", "n", "no"]:
-                        i = Session().console.input("Select 'y' or 'n' to proceed: ")
-                        Session().console.print("")
+                        i = session.console.input("Select 'y' or 'n' to proceed: ")
+                        session.console.print("")
 
                     if i.lower() in ["n", "no"]:
                         new_name = (
@@ -639,7 +640,7 @@ class BaseController(metaclass=ABCMeta):
                             "routines",
                             new_name,
                         )
-                        Session().console.print(
+                        session.console.print(
                             f"[yellow]The routine name has been updated to '{new_name}'[/yellow]\n"
                         )
 
@@ -650,7 +651,7 @@ class BaseController(metaclass=ABCMeta):
                     lines = ["# OpenBB Platform CLI - Routine", "\n"]
 
                     username = getattr(
-                        Session().user.profile.hub_session, "username", "local"
+                        session.user.profile.hub_session, "username", "local"
                     )
 
                     lines += [f"# Author: {username}", "\n\n"] if username else ["\n"]
@@ -666,13 +667,13 @@ class BaseController(metaclass=ABCMeta):
                     # Writing data to a file
                     file1.writelines(lines)
 
-                Session().console.print(
+                session.console.print(
                     f"[green]Your routine has been recorded and saved here: {routine_file}[/green]\n"
                 )
 
             # If user doesn't specify they want to store routine locally
             # Confirm that the user is logged in
-            elif not Session().is_local():
+            elif not session.is_local():
                 routine = "\n".join(SESSION_RECORDED[:-1])
                 hub_session = current_user.profile.hub_session
 
@@ -692,16 +693,16 @@ class BaseController(metaclass=ABCMeta):
                     }
                     response = upload_routine(**kwargs)  # type: ignore
                     if response is not None and response.status_code == 409:
-                        i = Session().console.input(
+                        i = session.console.input(
                             "A routine with the same name already exists, "
                             "do you want to replace it? (y/n): "
                         )
-                        Session().console.print("")
+                        session.console.print("")
                         if i.lower() in ["y", "yes"]:
                             kwargs["override"] = True  # type: ignore
                             response = upload_routine(**kwargs)  # type: ignore
                         else:
-                            Session().console.print("[info]Aborted.[/info]")
+                            session.console.print("[info]Aborted.[/info]")
 
             # Clear session to be recorded again
             RECORD_SESSION = False
@@ -718,14 +719,14 @@ class BaseController(metaclass=ABCMeta):
         ns_parser = self.parse_simple_args(parser, other_args)
 
         if ns_parser:
-            current_user = Session().user
-            local_user = Session().is_local()
+            current_user = session.user
+            local_user = session.is_local()
             if not local_user:
                 hub_session = current_user.profile.hub_session
-                Session().console.print(
+                session.console.print(
                     f"[info]email:[/info] {hub_session.email if hub_session else 'N/A'}"
                 )
-                Session().console.print(
+                session.console.print(
                     f"[info]uuid:[/info] {hub_session.user_uuid if hub_session else 'N/A'}"
                 )
             else:
@@ -751,23 +752,23 @@ class BaseController(metaclass=ABCMeta):
             "-h", "--help", action="store_true", help="show this help message"
         )
 
-        if Session().settings.USE_CLEAR_AFTER_CMD:
+        if session.settings.USE_CLEAR_AFTER_CMD:
             system_clear()
 
         try:
             (ns_parser, l_unknown_args) = parser.parse_known_args(other_args)
         except SystemExit:
             # In case the command has required argument that isn't specified
-            Session().console.print("\n")
+            session.console.print("\n")
             return None
 
         if ns_parser.help:
             txt_help = parser.format_help()
-            Session().console.print(f"[help]{txt_help}[/help]")
+            session.console.print(f"[help]{txt_help}[/help]")
             return None
 
         if l_unknown_args:
-            Session().console.print(
+            session.console.print(
                 f"The following args couldn't be interpreted: {l_unknown_args}\n"
             )
 
@@ -870,7 +871,7 @@ class BaseController(metaclass=ABCMeta):
                 help="Number of entries to show in data.",
                 type=check_positive,
             )
-        if Session().settings.USE_CLEAR_AFTER_CMD:
+        if session.settings.USE_CLEAR_AFTER_CMD:
             system_clear()
 
         if "--help" in other_args or "-h" in other_args:
@@ -880,7 +881,7 @@ class BaseController(metaclass=ABCMeta):
                     f"For more information and examples, use 'about {parser.prog}' "
                     f"to access the related guide.\n"
                 )
-            Session().console.print(f"[help]{txt_help}[/help]")
+            session.console.print(f"[help]{txt_help}[/help]")
             return None
 
         try:
@@ -910,14 +911,14 @@ class BaseController(metaclass=ABCMeta):
             setup.set_last_legend(" ".join(ns_parser.hold_legend_str))
 
         if l_unknown_args:
-            Session().console.print(
+            session.console.print(
                 f"The following args couldn't be interpreted: {l_unknown_args}"
             )
         return ns_parser
 
     def menu(self, custom_path_menu_above: str = ""):
         """Enter controller menu."""
-        settings = Session().settings
+        settings = session.settings
         an_input = "HELP_ME"
 
         while True:
@@ -948,7 +949,7 @@ class BaseController(metaclass=ABCMeta):
                     and an_input != "help"
                     and an_input.split(" ")[0] in self.controller_choices
                 ):
-                    Session().console.print(
+                    session.console.print(
                         f"{get_flair_and_username()} {self.PATH} $ {an_input}"
                     )
 
@@ -959,7 +960,7 @@ class BaseController(metaclass=ABCMeta):
                     self.print_help()
 
                 try:
-                    prompt_session = Session().prompt_session
+                    prompt_session = session.prompt_session
                     if prompt_session and settings.USE_PROMPT_TOOLKIT:
                         # Check if toolbar hint was enabled
                         if settings.TOOLBAR_HINT:
@@ -1002,7 +1003,7 @@ class BaseController(metaclass=ABCMeta):
                 self.queue = self.switch(an_input)
 
             except SystemExit:
-                Session().console.print(
+                session.console.print(
                     f"[red]The command '{an_input}' doesn't exist on the {self.PATH} menu.[/red]\n",
                 )
                 similar_cmd = difflib.get_close_matches(
@@ -1019,14 +1020,14 @@ class BaseController(metaclass=ABCMeta):
                         if candidate_input == an_input:
                             an_input = ""
                             self.queue = []
-                            Session().console.print("\n")
+                            session.console.print("\n")
                             continue
 
                         an_input = candidate_input
                     else:
                         an_input = similar_cmd[0]
 
-                    Session().console.print(
+                    session.console.print(
                         f"[green]Replacing by '{an_input}'.[/green]\n"
                     )
                     self.queue.insert(0, an_input)
diff --git a/cli/openbb_cli/controllers/base_platform_controller.py b/cli/openbb_cli/controllers/base_platform_controller.py
index c6b7d6b0374..0fc55c0ff1c 100644
--- a/cli/openbb_cli/controllers/base_platform_controller.py
+++ b/cli/openbb_cli/controllers/base_platform_controller.py
@@ -18,6 +18,8 @@ from openbb_cli.controllers.base_controller import BaseController
 from openbb_cli.controllers.utils import export_data, print_rich_table
 from openbb_cli.session import Session
 
+session = Session()
+
 
 class DummyTranslation:
     """Dummy Translation for testing."""
@@ -68,7 +70,7 @@ class PlatformController(BaseController):
             self._generate_commands()
             self._generate_sub_controllers()
 
-            if Session().prompt_session and Session().settings.USE_PROMPT_TOOLKIT:
+            if session.prompt_session and session.settings.USE_PROMPT_TOOLKIT:
                 choices: dict = self.choices_default
                 self.completer = NestedCompleter.from_nested_dict(choices)
 
@@ -180,7 +182,7 @@ class PlatformController(BaseController):
                         print_rich_table(df=df, show_index=True, title=title)
 
                     elif obbject:
-                        Session().console.print(obbject)
+                        session.console.print(obbject)
 
                     if hasattr(ns_parser, "export") and ns_parser.export:
                         sheet_name = getattr(ns_parser, "sheet_name", None)
@@ -194,7 +196,7 @@ class PlatformController(BaseController):
                         )
 
                 except Exception as e:
-                    Session().console.print(f"[red]{e}[/]\n")
+                    session.console.print(f"[red]{e}[/]\n")
                     return
 
         # Bind the method to the class
@@ -268,25 +270,25 @@ class PlatformController(BaseController):
 
         if self.CHOICES_MENUS:
             for menu in self.CHOICES_MENUS:
-                menu_description = self._get_menu_description(menu)
-                mt.add_menu(key_menu=menu, menu_description=menu_description)
+                description = self._get_menu_description(menu)
+                mt.add_menu(name=menu, description=description)
 
         if self.CHOICES_COMMANDS:
             mt.add_raw("\n")
             for command in self.CHOICES_COMMANDS:
                 command_description = self._get_command_description(command)
                 mt.add_cmd(
-                    key_command=command.replace(f"{self._name}_", ""),
-                    command_description=command_description,
+                    name=command.replace(f"{self._name}_", ""),
+                    description=command_description,
                 )
 
-        Session().console.print(text=mt.menu_text, menu=self._name)
+        session.console.print(text=mt.menu_text, menu=self._name)
 
-        settings = Session().settings
+        settings = session.settings
         dev_mode = settings.DEBUG_MODE or settings.TEST_MODE
         if mt.warnings and dev_mode:
-            Session().console.print("")
+            session.console.print("")
             for w in mt.warnings:
                 w_str = str(w).replace("{", "").replace("}", "").replace("'", "")
-                Session().console.print(f"[yellow]{w_str}[/yellow]")
-            Session().console.print("")
+                session.console.print(f"[yellow]{w_str}[/yellow]")
+            session.console.print("")
diff --git a/cli/openbb_cli/controllers/choices.py b/cli/openbb_cli/controllers/choices.py
index 7e66660ff79..aee144cf477 100644
--- a/cli/openbb_cli/controllers/choices.py
+++ b/cli/openbb_cli/controllers/choices.py
@@ -13,6 +13,8 @@ from openbb_cli.controllers.utils import (
 )
 from openbb_cli.session import Session
 
+session = Session()
+
 
 def __mock_parse_known_args_and_warn(
     controller,  # pylint: disable=unused-argument
@@ -206,7 +208,7 @@ def __patch_controller_functions(controller):
         ),
     ]
 
-    if not Session().settings.DEBUG_MODE:
+    if not session.settings.DEBUG_MODE:
         rich.start()
     patched_function_list = []
     for patcher in patcher_list:
@@ -214,7 +216,7 @@ def __patch_controller_functions(controller):
 
     yield patched_function_list
 
-    if not Session().settings.DEBUG_MODE:
+    if not session.settings.DEBUG_MODE:
         rich.stop()
     for patcher in patcher_list:
         patcher.stop()
@@ -314,7 +316,7 @@ def build_controller_choice_map(controller) -> dict:
                 argument_parser=argument_parser
             )
         except Exception as exception:
-            if Session().settings.DEBUG_MODE:
+            if session.settings.DEBUG_MODE:
                 raise Exception(
                     f"On command : `{command}`.\n{str(exception)}"
                 ) from exception
diff --git a/cli/openbb_cli/controllers/cli_controller.py b/cli/openbb_cli/controllers/cli_controller.py
index f6e0998fc2a..8c79ae6f842 100644
--- a/cli/openbb_cli/controllers/cli_controller.py
+++ b/cli/openbb_cli/controllers/cli_controller.py
@@ -66,6 +66,7 @@ DATA_PROCESSING_ROUTERS = ["technical", "quantitative", "econometrics"]
 logger = logging.getLogger(__name__)
 
 env_file = str(ENV_FILE_SETTINGS)
+session = Session()
 
 if is_installer():
     # Necessary for installer so that it can locate the correct certificates for
@@ -163,11 +164,9 @@ class CLIController(BaseController):
 
     def update_runtime_choices(self):
         """Update runtime choices."""
-        routines_directory = Path(
-            Session().user.preferences.export_directory, "routines"
-        )
+        routines_directory = Path(session.user.preferences.export_directory, "routines")
 
-        if Session().prompt_session and Session().settings.USE_PROMPT_TOOLKIT:
+        if session.prompt_session and session.settings.USE_PROMPT_TOOLKIT:
             # choices: dict = self.choices_default
             choices: dict = {c: {} for c in self.controller_choices}  # type: ignore
             choices["hold"] = {c: None for c in ["on", "off", "-s", "--sameaxis"]}
@@ -241,8 +240,8 @@ class CLIController(BaseController):
                     .get("description")
                 ) or ""
                 mt.add_menu(
-                    key_menu=router,
-                    menu_description=menu_description.split(".")[0].lower(),
+                    name=router,
+                    description=menu_description.split(".")[0].lower(),
                 )
             else:
                 mt.add_cmd(router)
@@ -259,8 +258,8 @@ class CLIController(BaseController):
                         .get("description")
                     ) or ""
                     mt.add_menu(
-                        key_menu=router,
-                        menu_description=menu_description.split(".")[0].lower(),
+                        name=router,
+                        description=menu_description.split(".")[0].lower(),
                     )
                 else:
                     mt.add_cmd(router)
@@ -276,8 +275,8 @@ class CLIController(BaseController):
                     .get("description")
                 ) or ""
                 mt.add_menu(
-                    key_menu=router,
-                    menu_description=menu_description.split(".")[0].lower(),
+                    name=router,
+                    description=menu_description.split(".")[0].lower(),
                 )
             else:
                 mt.add_cmd(router)
@@ -285,7 +284,7 @@ class CLIController(BaseController):
         mt.add_raw("\n    cached results (OBBjects)\n")
         mt.add_cmd("results")
 
-        Session().console.print(text=mt.menu_text, menu="Home")
+        session.console.print(text=mt.menu_text, menu="Home")
         self.update_runtime_choices()
 
     def parse_input(self, an_input: str) -> List:
@@ -314,7 +313,7 @@ class CLIController(BaseController):
         other_args += self.queue
 
         if not other_args:
-            Session().console.print(
+            session.console.print(
                 "[info]Provide a path to the routine you wish to execute. For an example, please use "
                 "`exe --example` and for documentation and to learn how create your own script "
                 "type `about exe`.\n[/info]"
@@ -369,7 +368,7 @@ class CLIController(BaseController):
         if ns_parser:
             if ns_parser.example:
                 routine_path = ASSETS_DIRECTORY / "routines" / "routine_example.openbb"
-                Session().console.print(
+                session.console.print(
                     "[info]Executing an example, please type `about exe` "
                     "to learn how to create your own script.[/info]\n"
                 )
@@ -389,14 +388,12 @@ class CLIController(BaseController):
                 final_url = f"{url}?raw=true"
                 response = requests.get(final_url, timeout=10)
                 if response.status_code != 200:
-                    Session().console.print(
+                    session.console.print(
                         "[red]Could not find the requested script.[/red]"
                     )
                     return
                 routine_text = response.json()["script"]
-                file_path = Path(
-                    Session().user.preferences.export_directory, "routines"
-                )
+                file_path = Path(session.user.preferences.export_directory, "routines")
                 routine_path = file_path / file_name
                 with open(routine_path, "w") as file:
                     file.write(routine_text)
@@ -441,7 +438,7 @@ class CLIController(BaseController):
                 # issue in parsing the routine and therefore we don't want to feed it
                 # to the terminal
                 if err:
-                    Session().console.print(err)
+                    session.console.print(err)
                     return
 
                 self.queue = [
@@ -466,12 +463,12 @@ class CLIController(BaseController):
 
                     # Check if the directory exists
                     if os.path.isdir(export_path):
-                        Session().console.print(
+                        session.console.print(
                             f"Export data to be saved in the selected folder: '{export_path}'"
                         )
                     else:
                         os.makedirs(export_path)
-                        Session().console.print(
+                        session.console.print(
                             f"[green]Folder '{export_path}' successfully created.[/green]"
                         )
                     self.queue = self.queue[1:]
@@ -485,7 +482,7 @@ class CLIController(BaseController):
                 df, show_index=True, index_name="stack index", title="OBBject Results"
             )
         else:
-            Session().console.print("[info]No results found.[/info]")
+            session.console.print("[info]No results found.[/info]")
 
 
 def handle_job_cmds(jobs_cmds: Optional[List[str]]) -> Optional[List[str]]:
@@ -513,12 +510,12 @@ def handle_job_cmds(jobs_cmds: Optional[List[str]]) -> Optional[List[str]]:
 
     # Check if the directory exists
     if os.path.isdir(export_path):
-        Session().console.print(
+        session.console.print(
             f"Export data to be saved in the selected folder: '{export_path}'"
         )
     else:
         os.makedirs(export_path)
-        Session().console.print(
+        session.console.print(
             f"[green]Folder '{export_path}' successfully created.[/green]"
         )
     return jobs_cmds
@@ -560,16 +557,16 @@ def run_cli(jobs_cmds: Optional[List[str]] = None, test_mode=False):
 
             # Print the current location because this was an instruction and we want user to know what was the action
             if an_input and an_input.split(" ")[0] in t_controller.CHOICES_COMMANDS:
-                Session().console.print(f"{get_flair_and_username()} / $ {an_input}")
+                session.console.print(f"{get_flair_and_username()} / $ {an_input}")
 
         # Get input command from user
         else:
             try:
                 # Get input from user using auto-completion
-                if Session().prompt_session and Session().settings.USE_PROMPT_TOOLKIT:
+                if session.prompt_session and session.settings.USE_PROMPT_TOOLKIT:
                     # Check if toolbar hint was enabled
-                    if Session().settings.TOOLBAR_HINT:
-                        an_input = Session().prompt_session.prompt(  # type: ignore[union-attr]
+                    if session.settings.TOOLBAR_HINT:
+                        an_input = session.prompt_session.prompt(  # type: ignore[union-attr]
                             f"{get_flair_and_username()} / $ ",
                             completer=t_controller.completer,
                             search_ignore_case=True,
@@ -588,7 +585,7 @@ def run_cli(jobs_cmds: Optional[List[str]] = None, test_mode=False):
                             ),
                         )
                     else:
-                        an_input = Session().prompt_session.prompt(  # type: ignore[union-attr]
+                        an_input = session.prompt_session.prompt(  # type: ignore[union-attr]
                             f"{get_flair_and_username()} / $ ",
                             completer=t_controller.completer,
                             search_ignore_case=True,
@@ -620,7 +617,7 @@ def run_cli(jobs_cmds: Optional[List[str]] = None, test_mode=False):
                 "The command '%s' doesn't exist on the / menu.",
                 an_input,
             )
-            Session().console.print(
+            session.console.print(
                 f"[red]The command '{an_input}' doesn't exist on the / menu.[/red]\n",
             )
             similar_cmd = difflib.get_close_matches(
@@ -638,11 +635,11 @@ def run_cli(jobs_cmds: Optional[List[str]] = None, test_mode=False):
                     if candidate_input == an_input:
                         an_input = ""
                         t_controller.queue = []
-                        Session().console.print("\n")
+                        session.console.print("\n")
                         continue
                     an_input = candidate_input
 
-                Session().console.print(f"[green]Replacing by '{an_input}'.[/green]")
+                session.console.print(f"[green]Replacing by '{an_input}'.[/green]")
                 t_controller.queue.insert(0, an_input)
 
 
@@ -682,7 +679,7 @@ def run_scripts(
         Whether to log tests to txt files
     """
     if not path.exists():
-        Session().console.print(f"File '{path}' doesn't exist. Launching base CLI.\n")
+        session.console.print(f"File '{path}' doesn't exist. Launching base CLI.\n")
         if not test_mode:
             run_cli()
 
@@ -736,7 +733,7 @@ def run_scripts(
             run_cli(file_cmds, test_mode=True)
         else:
             with suppress_stdout():
-                Session().console.print(f"To ensure: {output}")
+                session.console.print(f"To ensure: {output}")
                 if output:
                     timestamp = datetime.now().timestamp()
                     stamp_str = str(timestamp).replace(".", "")
@@ -777,7 +774,7 @@ def replace_dynamic(match: re.Match, special_arguments: Dict[str, str]) -> str:
 
 def run_routine(file: str, routines_args=Optional[str]):
     """Execute command routine from .openbb file."""
-    user_routine_path = Path(Session().user.preferences.export_directory, "routines")
+    user_routine_path = Path(session.user.preferences.export_directory, "routines")
     default_routine_path = ASSETS_DIRECTORY / "routines" / file
 
     if user_routine_path.exists():
@@ -785,7 +782,7 @@ def run_routine(file: str, routines_args=Optional[str]):
     elif default_routine_path.exists():
         run_scripts(path=default_routine_path, routines_args=routines_args)
     else:
-        Session().console.print(
+        session.console.print(
             f"Routine not found, please put your `.openbb` file into : {user_routine_path}."
         )
 
@@ -819,12 +816,12 @@ def main(
         E.g. GME,AMC,BTC-USD
     """
     if debug:
-        Session().settings.DEBUG_MODE = True
+        session.settings.DEBUG_MODE = True
 
     if dev:
-        Session().settings.DEV_BACKEND = True
-        Session().settings.BASE_URL = "https://payments.openbb.dev/"
-        Session().settings.HUB_URL = "https://my.openbb.dev"
+        session.settings.DEV_BACKEND = True
+        session.settings.BASE_URL = "https://payments.openbb.dev/"
+        session.settings.HUB_URL = "https://my.openbb.dev"
 
     if isinstance(path_list, list) and path_list[0].endswith(".openbb"):
         run_routine(file=path_list[0], routines_args=routines_args)
@@ -917,7 +914,7 @@ def parse_args_and_run():
     # Use -d flag if you want to see the unknown args.
     if unknown:
         if ns_parser.debug:
-            Session().console.print(unknown)
+            session.console.print(unknown)
         else:
             sys.exit(-1)
 
diff --git a/cli/openbb_cli/controllers/feature_flags_controller.py b/cli/openbb_cli/controllers/feature_flags_controller.py
index 860cd98a819..d6de826964b 100644
--- a/cli/openbb_cli/controllers/feature_flags_controller.py
+++ b/cli/openbb_cli/controllers/feature_flags_controller.py
@@ -13,6 +13,8 @@ from openbb_cli.controllers.base_controller import BaseController
 from openbb_cli.controllers.utils import all_timezones, is_timezone_valid
 from openbb_cli.session import Session
 
+session = Session()
+
 
 class FeatureFlagsController(BaseController):
     """Feature Flags Controller class."""
@@ -46,13 +48,13 @@ class FeatureFlagsController(BaseController):
         """Initialize the Constructor."""
         super().__init__(queue)
 
-        if Session().prompt_session and Session().settings.USE_PROMPT_TOOLKIT:
+        if session.prompt_session and session.settings.USE_PROMPT_TOOLKIT:
             choices: dict = self.choices_default
             self.completer = NestedCompleter.from_nested_dict(choices)
 
     def print_help(self):
         """Print help."""
-        settings = Session().settings
+        settings = session.settings
 
         mt = MenuText("settings/")
         mt.add_info("_info_")
@@ -76,63 +78,61 @@ class FeatureFlagsController(BaseController):
         mt.add_cmd("n_rows")
         mt.add_cmd("n_cols")
 
-        Session().console.print(text=mt.menu_text, menu="Feature Flags")
+        session.console.print(text=mt.menu_text, menu="Feature Flags")
 
     def call_overwrite(self, _):
         """Process overwrite command."""
-        Session().settings.set_item(
-            "FILE_OVERWRITE", not Session().settings.FILE_OVERWRITE
-        )
+        session.settings.set_item("FILE_OVERWRITE", not session.settings.FILE_OVERWRITE)
 
     def call_version(self, _):
         """Process version command."""
-        Session().settings.SHOW_VERSION = not Session().settings.SHOW_VERSION
+        session.settings.SHOW_VERSION = not session.settings.SHOW_VERSION
 
     def call_interactive(self, _):
         """Process interactive command."""
-        Session().settings.set_item(
-            "USE_INTERACTIVE_DF", not Session().settings.USE_INTERACTIVE_DF
+        session.settings.set_item(
+            "USE_INTERACTIVE_DF", not session.settings.USE_INTERACTIVE_DF
         )
 
     def call_cls(self, _):
         """Process cls command."""
-        Session().settings.set_item(
-            "USE_CLEAR_AFTER_CMD", not Session().settings.USE_CLEAR_AFTER_CMD
+        session.settings.set_item(
+            "USE_CLEAR_AFTER_CMD", not session.settings.USE_CLEAR_AFTER_CMD
         )
 
     def call_promptkit(self, _):
         """Process promptkit command."""
-        Session().settings.set_item(
-            "USE_PROMPT_TOOLKIT", not Session().settings.USE_PROMPT_TOOLKIT
+        session.settings.set_item(
+            "USE_PROMPT_TOOLKIT", not session.settings.USE_PROMPT_TOOLKIT
         )
 
     def call_exithelp(self, _):
         """Process exithelp command."""
-        Session().settings.set_item(
-            "ENABLE_EXIT_AUTO_HELP", not Session().settings.ENABLE_EXIT_AUTO_HELP
+        session.settings.set_item(
+            "ENABLE_EXIT_AUTO_HELP", not session.settings.ENABLE_EXIT_AUTO_HELP
         )
 
     def call_rcontext(self, _):
         """Process rcontext command."""
-        Session().settings.set_item(
-            "REMEMBER_CONTEXTS", not Session().settings.REMEMBER_CONTEXTS
+        session.settings.set_item(
+            "REMEMBER_CONTEXTS", not session.settings.REMEMBER_CONTEXTS
         )
 
     def call_dt(self, _):
         """Process dt command."""
-        Session().settings.set_item("USE_DATETIME", not Session().settings.USE_DATETIME)
+        session.settings.set_item("USE_DATETIME", not session.settings.USE_DATETIME)
 
     def call_richpanel(self, _):
         """Process richpanel command."""
-        Session().settings.set_item(
-            "ENABLE_RICH_PANEL", not Session().settings.ENABLE_RICH_PANEL
+        session.settings.set_item(
+            "ENABLE_RICH_PANEL", not session.settings.ENABLE_RICH_PANEL
         )
 
     def call_tbhint(self, _):
         """Process tbhint command."""
-        if Session().settings.TOOLBAR_HINT:
-            Session().console.print("Will take effect when running CLI again.")
-        Session().settings.set_item("TOOLBAR_HINT", not Session().settings.TOOLBAR_HINT)
+        if session.settings.TOOLBAR_HINT:
+            session.console.print("Will take effect when running CLI again.")
+        session.settings.set_item("TOOLBAR_HINT", not session.settings.TOOLBAR_HINT)
 
     def call_console_style(self, other_args: List[str]) -> None:
         """Process cosole_style command."""
@@ -148,16 +148,16 @@ class FeatureFlagsController(BaseController):
             dest="style",
             action="store",
             required=False,
-            choices=Session().style.available_styles,
+            choices=session.style.available_styles,
         )
         ns_parser = self.parse_simple_args(parser, other_args)
 
         if ns_parser and ns_parser.style:
-            Session().style.apply(ns_parser.style)
-            Session().settings.set_item("RICH_STYLE", ns_parser.style)
+            session.style.apply(ns_parser.style)
+            session.settings.set_item("RICH_STYLE", ns_parser.style)
         elif not other_args:
-            Session().console.print(
-                f"Current console style: {Session().settings.RICH_STYLE}"
+            session.console.print(
+                f"Current console style: {session.settings.RICH_STYLE}"
             )
 
     def call_flair(self, other_args: List[str]) -> None:
@@ -179,9 +179,9 @@ class FeatureFlagsController(BaseController):
         ns_parser = self.parse_simple_args(parser, other_args)
 
         if ns_parser and ns_parser.flair:
-            Session().settings.set_item("FLAIR", ns_parser.flair)
+            session.settings.set_item("FLAIR", ns_parser.flair)
         elif not other_args:
-            Session().console.print(f"Current flair: {Session().settings.FLAIR}")
+            session.console.print(f"Current flair: {session.settings.FLAIR}")
 
     def call_timezone(self, other_args: List[str]) -> None:
         """Process timezone command."""
@@ -198,21 +198,22 @@ class FeatureFlagsController(BaseController):
             action="store",
             required=False,
             type=str,
+            choices=all_timezones,
         )
         ns_parser = self.parse_simple_args(parser, other_args)
 
         if ns_parser and ns_parser.timezone:
             if is_timezone_valid(ns_parser.timezone):
-                Session().settings.set_item("TIMEZONE", ns_parser.timezone)
+                session.settings.set_item("TIMEZONE", ns_parser.timezone)
             else:
-                Session().console.print(
+                session.console.print(
                     "Invalid timezone. Please enter a valid timezone."
                 )
-                Session().console.print(
+                session.console.print(
                     f"Available timezones are: {', '.join(all_timezones)}"
                 )
         elif not other_args:
-            Session().console.print(f"Current timezone: {Session().settings.TIMEZONE}")
+            session.console.print(f"Current timezone: {session.settings.TIMEZONE}")
 
     def call_language(self, other_args: List[str]) -> None:
         """Process language command."""
@@ -233,12 +234,10 @@ class FeatureFlagsController(BaseController):
         ns_parser = self.parse_simple_args(parser, other_args)
 
         if ns_parser and ns_parser.language:
-            Session().settings.set_item("USE_LANGUAGE", ns_parser.language)
+            session.settings.set_item("USE_LANGUAGE", ns_parser.language)
 
         elif not other_args:
-            Session().console.print(
-                f"Current language: {Session().settings.USE_LANGUAGE}"
-            )
+            session.console.print(f"Current language: {session.settings.USE_LANGUAGE}")
 
     def call_n_rows(self, other_args: List[str]) -> None:
         """Process n_rows command."""
@@ -259,11 +258,11 @@ class FeatureFlagsController(BaseController):
         ns_parser = self.parse_simple_args(parser, other_args)
 
         if ns_parser and ns_parser.rows:
-            Session().settings.set_item("ALLOWED_NUMBER_OF_ROWS", ns_parser.rows)
+            session.settings.set_item("ALLOWED_NUMBER_OF_ROWS", ns_parser.rows)
 
         elif not other_args:
-            Session().console.print(
-                f"Current number of rows: {Session().settings.ALLOWED_NUMBER_OF_ROWS}"
+            session.console.print(
+                f"Current number of rows: {session.settings.ALLOWED_NUMBER_OF_ROWS}"
             )
 
     def call_n_cols(self, other_args: List[str]) -> None:
@@ -285,9 +284,9 @@ class FeatureFlagsController(BaseController):
         ns_parser = self.parse_simple_args(parser, other_args)
 
         if ns_parser and ns_parser.columns:
-            Session().settings.set_item("ALLOWED_NUMBER_OF_COLUMNS", ns_parser.columns)
+            session.settings.set_item("ALLOWED_NUMBER_OF_COLUMNS", ns_parser.columns)
 
         elif not other_args:
-            Session().console.print(
-                f"Current number of columns: {Session().settings.ALLOWED_NUMBER_OF_COLUMNS}"
+            session.console.print(
+                f"Current number of columns: {session.settings.ALLOWED_NUMBER_OF_COLUMNS}"
             )
diff --git a/cli/openbb_cli/controllers/hub_service.py b/cli/openbb_cli/controllers/hub_service.py
index aa44ebcc41c..8a63f701604 100644
--- a/cli/openbb_cli/controllers/hub_service.py
+++ b/cli/openbb_cli/controllers/hub_service.py
@@ -16,6 +16,9 @@ from openbb_cli.session import Session
 # created new directory structure to account for personal and default routines
 
 
+session = Session()
+
+
 # pylint: disable=too-many-arguments
 def upload_routine(
     auth_header: str,
@@ -57,26 +60,26 @@ def upload_routine(
         "script": routine,
         "override": override,
         "tags": tags,
-        "version": Session().settings.VERSION,
+        "version": session.settings.VERSION,
         "public": public,
     }
-    _console = Session().console
+    _console = session.console
     try:
         response = requests.post(
             headers={"Authorization": auth_header},
-            url=Session().settings.BASE_URL + "/terminal/script",
+            url=session.settings.BASE_URL + "/terminal/script",
             json=data,
             timeout=timeout,
         )
         if response.status_code == 200:
-            username = getattr(Session().user.profile.hub_session, "username", None)
+            username = getattr(session.user.profile.hub_session, "username", None)
             if not username:
                 _console.print("[red]No username found.[/red]")
                 _console.print("[red]Failed to upload your routine.[/red]")
                 return None
             _console.print("[green]Successfully uploaded your routine.[/]")
 
-            hub_url = Session().settings.HUB_URL
+            hub_url = session.settings.HUB_URL
 
             if public:
                 _console.print(
diff --git a/cli/openbb_cli/controllers/script_parser.py b/cli/openbb_cli/controllers/script_parser.py
index 1dd48925253..69134fc6d8f 100644
--- a/cli/openbb_cli/controllers/script_parser.py
+++ b/cli/openbb_cli/controllers/script_parser.py
@@ -7,6 +7,8 @@ from typing import Dict, List, Match, Optional, Tuple, Union
 from dateutil.relativedelta import relativedelta
 from openbb_cli.session import Session
 
+session = Session()
+
 # pylint: disable=too-many-statements,eval-used,consider-iterating-dictionary
 # pylint: disable=too-many-branches,too-many-return-statements
 
@@ -194,7 +196,7 @@ def parse_openbb_script(  # noqa: PLR0911,PLR0912
                 # Just throw a warning when user uses wrong convention
                 numdollars = len(re.findall(r"\$", line))
                 if numdollars > 1:
-                    Session().console.print(
+                    session.console.print(
                         f"The variable {VAR_NAME} should not be declared as "
                         f"{'$' * numdollars}{VAR_NAME}. Instead it will be "
                         f"converted into ${VAR_NAME}."
@@ -445,7 +447,7 @@ def parse_openbb_script(  # noqa: PLR0911,PLR0912
                             final_lines.append(foreach_line_loop.strip())
 
                 if not varused_inside:
-                    Session().console.print(
+                    session.console.print(
                         f"The variable {varname} was used in foreach header "
                         "but it wasn't used inside the loop."
                     )
-- 
cgit v1.2.3